ChemNet > CAS > 2912-62-1 DL-2-Chloro-2-phenylacetyl chloride
2912-62-1 DL-2-Chloro-2-phenylacetyl chloride
| product Name |
DL-2-Chloro-2-phenylacetyl chloride |
| CAS No |
2912-62-1 |
| Synonyms |
Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
| Molecular Formula |
C8H6Cl2O |
| Molecular Weight |
189.0386 |
| InChI |
InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
| EINECS |
220-826-7 |
| Molecular Structure |
|
| Density |
1.322g/cm3 |
| Boiling point |
228°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
104.4°C |
| Vapour Pressur |
0.0753mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
